Organic Chemistry, Analytical Chemistry, Biochemistry, Physical Chemistry, Computational Chemistry, Theoretical Chemistry, High School Chemistry, Colledge Chemistry and University Chemistry Forum.
Share your chemistry ideas, discuss chemical problems, ask for help with scientific chemistry questions, inspire others by your chemistry vision!
Please feel free to start a scientific chemistry discussion here!
Discuss chemistry homework problems with experts!
Ask for help with chemical questions and help others with your chemistry knowledge!
I was doing practice questions and I answered this incorrectly, and I can't wrap my head around it. It'll be hard to explain w/o a picture, but I'll try my best.
The structure is a synthetic macrocyclic ion consisting of a 18-crown-6 backbone (has a bunch of ether groups). It contains two substituents "X" and "Y". Both of them are located in b/w the two ether groups, like this. O-CH(Y)-CH(X)-O.
Y is wedged and X is dashed.
X = CO2H
Y = C(=O)N(n-Pr)CH2CH2OCH2CH2N(n-Pr)CO2CH2C6H5
My initial answer is that the chiral carbon w/ X is (S) and the chiral carbon w/ Y is also (S). But that is wrong, it's saying the answer is R,R but how?
In the case of Y, isn't the O group connected to the chiral carbon the 1st priority? (due to higher atomic #). If that's the case, the priority would be counterclockwise making it (S). Same with X, it would be R, flip it b/c hydrogen is wedged and it would also be S. But it's saying R,R.
Please help. I apologize for the long amount of text.
Without a photo it's difficult to say.One thing is that you have to rearrange the substituents in the way that hydrogen is on bottom, means get dashed. The other 3 then like a Mercrdes Star. Priorität is O, then CO then CHX or CHY in the other case.
the dajjal wrote: ↑Mon Jul 07, 2025 7:09 pm
I was doing practice questions and I answered this incorrectly, and I can't wrap my head around it. It'll be hard to explain w/o a picture, but I'll try my best.
The structure is a synthetic macrocyclic ion consisting of a 18-crown-6 backbone (has a bunch of ether groups). It contains two substituents "X" and "Y". Both of them are located in b/w the two ether groups, like this. O-CH(Y)-CH(X)-O.
Y is wedged and X is dashed.
X = CO2H
Y = C(=O)N(n-Pr)CH2CH2OCH2CH2N(n-Pr)CO2CH2C6H5
My initial answer is that the chiral carbon w/ X is (S) and the chiral carbon w/ Y is also (S). But that is wrong, it's saying the answer is R,R but how?
In the case of Y, isn't the O group connected to the chiral carbon the 1st priority? (due to higher atomic #). If that's the case, the priority would be counterclockwise making it (S). Same with X, it would be R, flip it b/c hydrogen is wedged and it would also be S. But it's saying R,R.
Please help. I apologize for the long amount of text.
The key is that you're assigning priorities correctly, but remember to trace the path from the highest to lowest priority while placing the lowest priority group (usually hydrogen) in the back, and in both cases here, the wedge/dash orientation means the configurations appear inverted—so your (S) assignments flip to R once you properly account for the 3D geometry.
the dajjal wrote: ↑Mon Jul 07, 2025 7:09 pm
I was doing practice questions and I answered this incorrectly, and I can't wrap my head around it. It'll be hard to explain w/o a picture, but I'll try my best.
The structure is a synthetic macrocyclic ion consisting of a 18-crown-6 backbone (has a bunch of ether groups). It contains two substituents "X" and "Y". Both of them are located in b/w the two ether groups, like this. O-CH(Y)-CH(X)-O.
Y is wedged and X is dashed.
X = CO2H
Y = C(=O)N(n-Pr)CH2CH2OCH2CH2N(n-Pr)CO2CH2C6H5
My initial answer is that the chiral carbon w/ X is (S) and the chiral carbon w/ Y is also (S). But that is wrong, it's saying the answer is R,R but how?
In the case of Y, isn't the O group connected to the chiral carbon the 1st priority? (due to higher atomic #). If that's the case, the priority would be counterclockwise making it (S). Same with X, it would be R, flip it b/c hydrogen is wedged and it would also be S. But it's saying R,R.
Please help. I apologize for the long amount of text.
You're assigning priorities correctly in theory, but for both chiral centers, you're likely misinterpreting the 3D orientation, remember to first assign priorities then orient the molecule so the lowest priority group (usually H) is pointing away before determining R/S.
