Question pertaining to R/S designation.
Posted: Mon Jul 07, 2025 7:09 pm
I was doing practice questions and I answered this incorrectly, and I can't wrap my head around it. It'll be hard to explain w/o a picture, but I'll try my best.
The structure is a synthetic macrocyclic ion consisting of a 18-crown-6 backbone (has a bunch of ether groups). It contains two substituents "X" and "Y". Both of them are located in b/w the two ether groups, like this. O-CH(Y)-CH(X)-O.
Y is wedged and X is dashed.
X = CO2H
Y = C(=O)N(n-Pr)CH2CH2OCH2CH2N(n-Pr)CO2CH2C6H5
My initial answer is that the chiral carbon w/ X is (S) and the chiral carbon w/ Y is also (S). But that is wrong, it's saying the answer is R,R but how?
In the case of Y, isn't the O group connected to the chiral carbon the 1st priority? (due to higher atomic #). If that's the case, the priority would be counterclockwise making it (S). Same with X, it would be R, flip it b/c hydrogen is wedged and it would also be S. But it's saying R,R.
Please help. I apologize for the long amount of text.
The structure is a synthetic macrocyclic ion consisting of a 18-crown-6 backbone (has a bunch of ether groups). It contains two substituents "X" and "Y". Both of them are located in b/w the two ether groups, like this. O-CH(Y)-CH(X)-O.
Y is wedged and X is dashed.
X = CO2H
Y = C(=O)N(n-Pr)CH2CH2OCH2CH2N(n-Pr)CO2CH2C6H5
My initial answer is that the chiral carbon w/ X is (S) and the chiral carbon w/ Y is also (S). But that is wrong, it's saying the answer is R,R but how?
In the case of Y, isn't the O group connected to the chiral carbon the 1st priority? (due to higher atomic #). If that's the case, the priority would be counterclockwise making it (S). Same with X, it would be R, flip it b/c hydrogen is wedged and it would also be S. But it's saying R,R.
Please help. I apologize for the long amount of text.