We are trying to produce basic lead carbonate using the following ways,
1. Prepare basic lead acetate solution: 3PbO+2CH3COOH+H2O=Pb(CH3COO)2.2Pb(OH)2
2. introduce CO2 to get basic lead carbonate: Pb(CH3COO)2.2Pb(OH)2+2CO2=2PbCO3.Pb(OH)2+2CH3COOH
In theory, the HAc(CH3COOH) can be fully recovered and used in the new cycle of producing, but
in fact we can not get any HAc(CH3COOH) after we get basic lead carbonate. We have to use same
PbO:CH3COOH in the new cycle of reaction, which made our cost very high.
Can any kind engineers/professors help us?
E-mail: chemarea@126.com
Need help in producing basic lead carbonate
Moderators: Xen, expert, ChenBeier