Chemistry Forum

CaO + H2O <=> Ca&#40;OH&#41;2 , ∆H = -65kJ/mol You are using a surfactant foam to disburse an insoluble powder and thus increase the rate of the reaction due to greater surface area of the solid reagent available to react with the liquid reagent (water). You are not releasing more energy,...

That is the net ionic equation.

I assume that 10 u is meant to be ?

Then it is in .

So dissolve of assay in of distilled water.

NaCl + AgNO3 = AgCl&#40;s&#41; + NaNO3 InCl3 + 3 AgNO3 = 3 AgCl&#40;s&#41; + In&#40;NO3&#41;3 So assuming your sample contained x mole of sodium chloride and y mole of indium chloride, then you will have precipitated &#40;x+3y&#41; of silver chloride. Look up the mol...

The bacteria generate ammonia, locally raising the pH. NH2+ H2O = NH4OH This ammonium reacts with bicarbonate and calcium ions in the hypersaline water. 2 NH4OH + Ca&#40;HCO3&#41;2 = 2 NH4HCO3 + Ca&#40;OH&#41;2 ... resulting in the direct precipitation of calcium carbonate, limestone...

ptech785 wrote:Write the balanced equation for the reaction of sulfurous acid with dichromate ion.

Homework questions will get better answers if you indicate what you've attempted on your own.

Sulfurous acid is Dichromate ion is

... what compound?

How many grams of water are made from the reaction of 16.0 grams of oxygen gas and 40.3 grams of hydrogen gas? Given the reaction: 2 H2 + O2 → 2 H2O O2 : Sample weight: 16.0g molecular mass: 31.99880 ± 0.00060 g/mol H2 Sample weight: 40.3g Molecular mass: 2.01588 ± 0.00014 g/mol H2O Molecular m...

Hey guys on a sheet I was given I was asked to write the formula for "Copper (ll) nitrate dissolved in water reacts with solid magnesium metal to yield aqueous magnesium nitrate and solid copper." I wanted to see if Cu&#40;NO3&#41;2*H2O+Mg = Mg&#40;NO3&#41;2+ Cu was correc...

Rodrigo Pires wrote:Hi, in this reaction what is the product?

Code: Select all

2 NaC6H7O7 + H2SO4 = 2C6H8O7 + NaHSO4

or

Code: Select all

NaC6H7O7 + H2SO4 = C6H8O7 + Na2SO4

Thanks.

It depends, as both are valid products, so they are competing reactions. The former is more likely to form from dilute acid, the latter in concentrated.

1> 2>

Looks about right.

CH3CH&#40;CH3&#41;2CHBrCHBrCH&#40;CH3&#41;2CH3 is (R,S)-3,4-dibromo-2,2,5,5-tetramethyl-hexane CC(C)(C)[C@@H](Br)[C@H](Br)C(C)(C)C CH3CHICH&#40;CH3&#41;CH2CH2C&#40;NH2&#41;&#40;CH3&#41;CH3 is (S,S)-6-iodo-2,5-dimethyl-2-heptamine CC(C)(N)CC[C@H](C)[C@H](I)C

We have two red/ox reagent pairs, one spectator ion, in basic solution. Separate the half reactions. Put potassium to the side for now as it's a spectator ion (it is neither reduced not oxidised). MnO4&#123;-&#125; + _ = MnO2 + _ C3H8O2 + _ = C3H2O4&#123;2-&#125; + _ Since Mn and C d...