Chemistry Forum

GrahamKemp

Cannot be balanced.

Try without the hydroxide anion.

2 RH + CO3&#123;2-&#125; = 2 R&#123;-&#125; + CO2 + H2O

Try without the carboxic anion

Code: Select all

RH + OH&#123;-&#125; = R&#123;-&#125; + H2O

Conclude that you had a combination of reactions.

GrahamKemp

ICl3+H2O = ICl + HIO3 + HCl The key is to remove distractions and reveal : I am positive. -Spectator: I{3+} = I{+} + IO3{-} 1/2 Equan: I{3+} = I{+} | I{3-} = IO3{-} Balance ...

GrahamKemp

If I want the equation in basic ambient shouldn't I have OH{-} in the products? In the reactants as it turns out. Take the equation O2 + Sb = H2O2 + SbO2{1-} Split into O2, Sb halves. O2 = H2O2 | Sb = SbO2{1-} Balance O O2 = H2O2 | Sb + 2 H2O = SbO2{1-&a...

GrahamKemp

Code: Select all

Fe2O3 + 3 C = 2 Fe + 3 CO

GrahamKemp

Hello. I stumbled across this problem when looking for some help in solving a practice problem for school. How would one balance this equation using the ion-electron method of redox. Thanks! Take the equation stripped of spectator ions, water, and its components. As given: IO3{-} ...

GrahamKemp

You can't just add electrons willy nihly, you have to have justification. In the hydrogen peroxide half equation, first balance the hydrogen with protons, and then balance the charge with electrons. H2O2 + 2 H{+} + 2 e{-} = 2 H2O In the iodide half reaction, rever...

GrahamKemp

faisal alam wrote:1.Ca2CO3=CaO+CO2
2.NaCl+AgNO3=AgCl+NaNO3

Are you asking if you have the equations correct, or balanced?

1. Almost, except there is only one calcium in calcium carbonate. So the decomposition is:

Code: Select all

CaCO3 = CaO + CO2

2. Yes. The double replacement reaction is:

Code: Select all

NaCl+AgNO3=AgCl+NaNO3

GrahamKemp

Nope. The reaction between Aluminium and Chloric Acid liberates Hydrogen, not Chlorine. Also, Al(Cl3)3 is nonsensical.; you dropped an O, so there is no need for water to balance the oxygen. It is a metal-acid reduction/oxidation. 2 Al + 6 HClO3 = 2 Al(ClO3)3 + 3 H2 &...

GrahamKemp

gtg244u wrote:
Code: Select all
 C4H12N2SO4 + NaOH = C4H10N2 + Na2SO4
Can anyone help me with this?

Just add water.

Code: Select all

XH2SO4 + 2 NaOH = X + Na2SO4 + H2O

Code: Select all

 C4H12N2SO4 + 2 NaOH = C4H10N2 + Na2SO4 + H2O

GrahamKemp

I need help... Sb2O3+KIO3+HCl+H2O=HSb(OH)6+KCl+ICl thanks. RedOx is happening! Get those spectator ions to safety. They're causing a distraction. Move the protons and water away too. Strip down to the bare essentials. Sb2O3 + IO3{-} + ? = Sb(OH)6&am...

GrahamKemp

Candelaria wrote:
Code: Select all
&#40;NH4&#41;2Cr2O7 + H2O2 + KOH --> K3&#91;Cr&#40;O2&#41;4&#93; + O2 + NH3 + H2O
Please give me instructions on balancing chemical equations
Thanks!

What is

Code: Select all

K3&#91;Cr&#40;O2&#41;4&#93;

GrahamKemp

KIO3 + KHSO3 Well, de]K{+}[/code] is most likely going to be a spectator ion, so that leaves reactants: IO3{-}+ HSO3{-} The liable products of these are: I{-} + H{+} + SO4{2-} So we need to balance: x IO3&...

GrahamKemp

Indeed. Or by hand, from:

Code: Select all

x Fe + y HC2H3O2 = x Fe&#40;C2H3O2&#41;3 + z H2

Start with the O (and C): 2y = 6x => y=6, x=2

Code: Select all

2 Fe + 6 HC2H3O2 = 2 Fe&#40;C2H3O2&#41;3 + z H2

Look to the H: 24 = 18 + 2z => z=3

Code: Select all

2 Fe + 6 HC2H3O2 = 2 Fe&#40;C2H3O2&#41;3 + 3 H2

GrahamKemp

You have a Neutral charge on LHS, and a load of Negative charges on RHS. So yes, you are wrong. Please balance those charges. Sb + 2 H2O = SbO2{-} + 4 H{+} + 3 e{-} O2 + 2 H{+} + 2 e{-} = H2O2 --- 3 O2 + 2 Sb +...

GrahamKemp

Tip: There's an easy to use pH calculator on the "Chemistry Tools" page

http://www.webqc.org/phsolver.php

You'll want to enter values for:

HCl pKa=-10 c=0.1 v=0.1

NaC2H3O2 Ka=1.0E-5 Kb=5.6E-10 c=0.1 v=0.15

Chemistry Forum

Search found 396 matches

Re: How Can i balance this reaction?

A bit late but

Re: Reaction

Re: Balance: C4H12N2SO4 + NaOH -> C4H10N2 + Na2SO4

Re: Balance algebraic method

Re: Hi! I need help please

Re: KIO3 + KHSO3 -> ?

Re: Steps to balance equation